C7H15O9PS — CID 156690326
ethyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate (PubChem CID 156690326) has the molecular formula C7H15O9PS and a molecular weight of 306.23 g/mol. Its IUPAC name is ethyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate.
| Compound Name | ethyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate |
|---|---|
| PubChem CID | 156690326 |
| Molecular Formula | C7H15O9PS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | ethyl [ethoxy(2-sulfooxyethoxy)phosphoryl]formate |
| SMILES | CCOC(=O)P(=O)(OCC)OCCOS(=O)(=O)O |
| InChI | InChI=1S/C7H15O9PS/c1-3-13-7(8)17(9,14-4-2)15-5-6-16-18(10,11)12/h3-6H2,1-2H3,(H,10,11,12) |
| InChIKey | HLTCQQYXIJFSBJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|