C16H38N2O9P2 — CID 173456268
azane;butoxy(carbamoyl)phosphinic acid;ethyl dibutoxyphosphorylformate (PubChem CID 173456268) has the molecular formula C16H38N2O9P2 and a molecular weight of 464.43 g/mol. Its IUPAC name is azane;butoxy(carbamoyl)phosphinic acid;ethyl dibutoxyphosphorylformate.
| Compound Name | azane;butoxy(carbamoyl)phosphinic acid;ethyl dibutoxyphosphorylformate |
|---|---|
| PubChem CID | 173456268 |
| Molecular Formula | C16H38N2O9P2 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | azane;butoxy(carbamoyl)phosphinic acid;ethyl dibutoxyphosphorylformate |
| SMILES | CCCCOP(=O)(O)C(N)=O.CCCCOP(=O)(OCCCC)C(=O)OCC.N |
| InChI | InChI=1S/C11H23O5P.C5H12NO4P.H3N/c1-4-7-9-15-17(13,11(12)14-6-3)16-10-8-5-2;1-2-3-4-10-11(8,9)5(6)7;/h4-10H2,1-3H3;2-4H2,1H3,(H2,6,7)(H,8,9);1H3 |
| InChIKey | SKEZSUQXIGKYLZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 186.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|