C14H14N3PS — CID 23415674
3-methyl-2,5-diphenyl-3-sulfanylidene-1H-1,2,4,3λ5-triazaphosphole (PubChem CID 23415674) has the molecular formula C14H14N3PS and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-methyl-2,5-diphenyl-3-sulfanylidene-1H-1,2,4,3λ5-triazaphosphole.
| Compound Name | 3-methyl-2,5-diphenyl-3-sulfanylidene-1H-1,2,4,3λ5-triazaphosphole |
|---|---|
| PubChem CID | 23415674 |
| Molecular Formula | C14H14N3PS |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-methyl-2,5-diphenyl-3-sulfanylidene-1H-1,2,4,3λ5-triazaphosphole |
| SMILES | CP1(=S)N=C(c2ccccc2)NN1c1ccccc1 |
| InChI | InChI=1S/C14H14N3PS/c1-18(19)16-14(12-8-4-2-5-9-12)15-17(18)13-10-6-3-7-11-13/h2-11H,1H3,(H,15,16,19) |
| InChIKey | GNIDYAWGEYUCNV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|