C7H16NO2PSe — CID 23416273
N,N,5,5-tetramethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 23416273) has the molecular formula C7H16NO2PSe and a molecular weight of 256.14 g/mol. Its IUPAC name is N,N,5,5-tetramethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | N,N,5,5-tetramethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 23416273 |
| Molecular Formula | C7H16NO2PSe |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N,N,5,5-tetramethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | CN(C)P1(=[Se])OCC(C)(C)CO1 |
| InChI | InChI=1S/C7H16NO2PSe/c1-7(2)5-9-11(12,8(3)4)10-6-7/h5-6H2,1-4H3 |
| InChIKey | JLVDAPMZXUINOL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|