About diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate
diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate (PubChem CID 23416460) has the molecular formula C15H27O8P
and a molecular weight of 366.35 g/mol. Its IUPAC name is diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate |
| PubChem CID | 23416460 |
| Molecular Formula | C15H27O8P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=P(CCC(=O)OC)(OCC)OCC |
| InChI | InChI=1S/C15H27O8P/c1-6-20-14(17)13(15(18)21-7-2)24(22-8-3,23-9-4)11-10-12(16)19-5/h6-11H2,1-5H3 |
| InChIKey | SMFYSZMSLYAQNE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate?
The IUPAC name of diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate (CID 23416460) is diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate.
What is the SMILES notation for diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate?
The canonical SMILES for diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate is CCOC(=O)C(C(=O)OCC)=P(CCC(=O)OC)(OCC)OCC.
What is the InChIKey of diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate?
The InChIKey is SMFYSZMSLYAQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27O8P/c1-6-20-14(17)13(15(18)21-7-2)24(22-8-3,23-9-4)11-10-12(16)19-5/h6-11H2,1-5H3.
What are the key properties of diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate?
diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate has a molecular weight of 366.35 g/mol, XLogP of 1.77, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[diethoxy-(3-methoxy-3-oxopropyl)-λ5-phosphanylidene]propanedioate is sourced from PubChem (CID 23416460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).