About bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane
bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane (PubChem CID 23418001) has the molecular formula C22H49O3PSSi
and a molecular weight of 452.76 g/mol. Its IUPAC name is bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane.
Molecular Properties
| Compound Name | bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane |
| PubChem CID | 23418001 |
| Molecular Formula | C22H49O3PSSi |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane |
| SMILES | CCCC[Si](CCCC)(CCCC)OP(=S)(OCC(C)(C)C)OCC(C)(C)C |
| InChI | InChI=1S/C22H49O3PSSi/c1-10-13-16-28(17-14-11-2,18-15-12-3)25-26(27,23-19-21(4,5)6)24-20-22(7,8)9/h10-20H2,1-9H3 |
| InChIKey | GANOPCZWTXFTKN-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane?
The IUPAC name of bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane (CID 23418001) is bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane.
What is the SMILES notation for bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane?
The canonical SMILES for bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane is CCCC[Si](CCCC)(CCCC)OP(=S)(OCC(C)(C)C)OCC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane?
The InChIKey is GANOPCZWTXFTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H49O3PSSi/c1-10-13-16-28(17-14-11-2,18-15-12-3)25-26(27,23-19-21(4,5)6)24-20-22(7,8)9/h10-20H2,1-9H3.
What are the key properties of bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane?
bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane has a molecular weight of 452.76 g/mol, XLogP of 8.70, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane is sourced from PubChem (CID 23418001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).