C22H49O3PSSi — CID 23418001
bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane (PubChem CID 23418001) has the molecular formula C22H49O3PSSi and a molecular weight of 452.76 g/mol. Its IUPAC name is bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane.
| Compound Name | bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane |
|---|---|
| PubChem CID | 23418001 |
| Molecular Formula | C22H49O3PSSi |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | bis(2,2-dimethylpropoxy)-sulfanylidene-tributylsilyloxy-λ5-phosphane |
| SMILES | CCCC[Si](CCCC)(CCCC)OP(=S)(OCC(C)(C)C)OCC(C)(C)C |
| InChI | InChI=1S/C22H49O3PSSi/c1-10-13-16-28(17-14-11-2,18-15-12-3)25-26(27,23-19-21(4,5)6)24-20-22(7,8)9/h10-20H2,1-9H3 |
| InChIKey | GANOPCZWTXFTKN-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|