CH4O8P2-2 — CID 23418291
[dihydroxy-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate (PubChem CID 23418291) has the molecular formula CH4O8P2-2 and a molecular weight of 205.98 g/mol. Its IUPAC name is [dihydroxy-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate.
| Compound Name | [dihydroxy-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 23418291 |
| Molecular Formula | CH4O8P2-2 |
| Molecular Weight | 205.98 g/mol |
| Exact Mass | 205.94 |
| IUPAC Name | [dihydroxy-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate |
| SMILES | O=P([O-])(O)C(O)(O)P(=O)([O-])O |
| InChI | InChI=1S/CH6O8P2/c2-1(3,10(4,5)6)11(7,8)9/h2-3H,(H2,4,5,6)(H2,7,8,9)/p-2 |
| InChIKey | VOCLSHIYPGYWJW-UHFFFAOYSA-L |
| XLogP | -3.33 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.98 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|