7H-purine-8-carboxylic acid

C6H4N4O2 — CID 23422044

IUPAC7H-purine-8-carboxylic acid
SMILESO=C(O)c1nc2ncncc2[nH]1
InChIInChI=1S/C6H4N4O2/c11-6(12)5-9-3-1-7-2-8-4(3)10-5/h1-2H,(H,11,12)(H,7,8,9,10)
InChIKeyQAJJXAGDCARCHD-UHFFFAOYSA-N
MW164.12 g/mol
LogP0.05
Rot. Bonds1

About 7H-purine-8-carboxylic acid

7H-purine-8-carboxylic acid (PubChem CID 23422044) has the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. Its IUPAC name is 7H-purine-8-carboxylic acid.

Molecular Properties

Compound Name7H-purine-8-carboxylic acid
PubChem CID23422044
Molecular FormulaC6H4N4O2
Molecular Weight164.12 g/mol
Exact Mass164.03
IUPAC Name7H-purine-8-carboxylic acid
SMILESO=C(O)c1nc2ncncc2[nH]1
InChIInChI=1S/C6H4N4O2/c11-6(12)5-9-3-1-7-2-8-4(3)10-5/h1-2H,(H,11,12)(H,7,8,9,10)
InChIKeyQAJJXAGDCARCHD-UHFFFAOYSA-N
XLogP0.05
TPSA91.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.12
LogP ≤ 50.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 7H-purine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7H-purine-8-carboxylic acid?
The IUPAC name of 7H-purine-8-carboxylic acid (CID 23422044) is 7H-purine-8-carboxylic acid.
What is the SMILES notation for 7H-purine-8-carboxylic acid?
The canonical SMILES for 7H-purine-8-carboxylic acid is O=C(O)c1nc2ncncc2[nH]1.
What is the InChIKey of 7H-purine-8-carboxylic acid?
The InChIKey is QAJJXAGDCARCHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-6(12)5-9-3-1-7-2-8-4(3)10-5/h1-2H,(H,11,12)(H,7,8,9,10).
What are the key properties of 7H-purine-8-carboxylic acid?
7H-purine-8-carboxylic acid has a molecular weight of 164.12 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-8-carboxylic acid is sourced from PubChem (CID 23422044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).