C6H8N4O2 — CID 23422079
2-[(4-aminopyrimidin-5-yl)amino]acetic acid (PubChem CID 23422079) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 2-[(4-aminopyrimidin-5-yl)amino]acetic acid.
| Compound Name | 2-[(4-aminopyrimidin-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 23422079 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2-[(4-aminopyrimidin-5-yl)amino]acetic acid |
| SMILES | Nc1ncncc1NCC(=O)O |
| InChI | InChI=1S/C6H8N4O2/c7-6-4(1-8-3-10-6)9-2-5(11)12/h1,3,9H,2H2,(H,11,12)(H2,7,8,10) |
| InChIKey | CSHYXPOXLYVKGH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |