C6H6N4O2 — CID 23422305
1-methyl-7,9-dihydropurine-2,8-dione (PubChem CID 23422305) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 1-methyl-7,9-dihydropurine-2,8-dione.
| Compound Name | 1-methyl-7,9-dihydropurine-2,8-dione |
|---|---|
| PubChem CID | 23422305 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-methyl-7,9-dihydropurine-2,8-dione |
| SMILES | Cn1cc2[nH]c(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C6H6N4O2/c1-10-2-3-4(9-6(10)12)8-5(11)7-3/h2H,1H3,(H2,7,8,9,11,12) |
| InChIKey | DDZZXNKFOQVQQL-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |