C9H13N4O2+ — CID 134891823
1,3,6,9-tetramethyl-7H-purin-3-ium-2,8-dione (PubChem CID 134891823) has the molecular formula C9H13N4O2+ and a molecular weight of 209.23 g/mol. Its IUPAC name is 1,3,6,9-tetramethyl-7H-purin-3-ium-2,8-dione.
| Compound Name | 1,3,6,9-tetramethyl-7H-purin-3-ium-2,8-dione |
|---|---|
| PubChem CID | 134891823 |
| Molecular Formula | C9H13N4O2+ |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,3,6,9-tetramethyl-7H-purin-3-ium-2,8-dione |
| SMILES | Cc1c2[nH]c(=O)n(C)c2[n+](C)c(=O)n1C |
| InChI | InChI=1S/C9H12N4O2/c1-5-6-7(12(3)8(14)10-6)13(4)9(15)11(5)2/h1-4H3/p+1 |
| InChIKey | NETMPZRJZPRRMP-UHFFFAOYSA-O |
| XLogP | -1.30 |
| TPSA | 63.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|