C9H11N5O2 — CID 14713812
N-(1,9-dimethyl-8-oxo-7H-purin-6-ylidene)acetamide (PubChem CID 14713812) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is N-(1,9-dimethyl-8-oxo-7H-purin-6-ylidene)acetamide.
| Compound Name | N-(1,9-dimethyl-8-oxo-7H-purin-6-ylidene)acetamide |
|---|---|
| PubChem CID | 14713812 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-(1,9-dimethyl-8-oxo-7H-purin-6-ylidene)acetamide |
| SMILES | CC(=O)/N=c1/c2[nH]c(=O)n(C)c2ncn1C |
| InChI | InChI=1S/C9H11N5O2/c1-5(15)11-8-6-7(10-4-13(8)2)14(3)9(16)12-6/h4H,1-3H3,(H,12,16)/b11-8- |
| InChIKey | FLJHBEIJDZKMNG-FLIBITNWSA-N |
| XLogP | -0.95 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |