C17H25N5O3 — CID 23422503
6-(2-pyridin-2-ylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione (PubChem CID 23422503) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 6-(2-pyridin-2-ylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione.
| Compound Name | 6-(2-pyridin-2-ylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione |
|---|---|
| PubChem CID | 23422503 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 6-(2-pyridin-2-ylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione |
| SMILES | O=C1CCNCCNC(=O)C(CCc2ccccn2)C(=O)NCCN1 |
| InChI | InChI=1S/C17H25N5O3/c23-15-6-8-18-9-10-21-16(24)14(17(25)22-12-11-20-15)5-4-13-3-1-2-7-19-13/h1-3,7,14,18H,4-6,8-12H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | FJLIDCKTHUTUHM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|