C14H28N2O4 — CID 23422571
N,N'-dihydroxy-N,N'-di(propan-2-yl)octanediamide (PubChem CID 23422571) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is N,N'-dihydroxy-N,N'-di(propan-2-yl)octanediamide.
| Compound Name | N,N'-dihydroxy-N,N'-di(propan-2-yl)octanediamide |
|---|---|
| PubChem CID | 23422571 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N,N'-dihydroxy-N,N'-di(propan-2-yl)octanediamide |
| SMILES | CC(C)N(O)C(=O)CCCCCCC(=O)N(O)C(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-11(2)15(19)13(17)9-7-5-6-8-10-14(18)16(20)12(3)4/h11-12,19-20H,5-10H2,1-4H3 |
| InChIKey | NAZICRNQPKGKKV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|