C10H11NO4S — CID 23422801
2-[N-(carboxymethyl)-2-sulfanylanilino]acetic acid (PubChem CID 23422801) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-2-sulfanylanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-2-sulfanylanilino]acetic acid |
|---|---|
| PubChem CID | 23422801 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 2-[N-(carboxymethyl)-2-sulfanylanilino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1ccccc1S |
| InChI | InChI=1S/C10H11NO4S/c12-9(13)5-11(6-10(14)15)7-3-1-2-4-8(7)16/h1-4,16H,5-6H2,(H,12,13)(H,14,15) |
| InChIKey | FEWXUHPGGBLFMD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|