C11H13F3N2O2 — CID 117013526
2-[N-(2-aminoethyl)-2-(trifluoromethyl)anilino]acetic acid (PubChem CID 117013526) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-[N-(2-aminoethyl)-2-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-[N-(2-aminoethyl)-2-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 117013526 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-[N-(2-aminoethyl)-2-(trifluoromethyl)anilino]acetic acid |
| SMILES | NCCN(CC(=O)O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)8-3-1-2-4-9(8)16(6-5-15)7-10(17)18/h1-4H,5-7,15H2,(H,17,18) |
| InChIKey | ROKVYIPTAAVYHL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |