C13H19F3N2 — CID 55218520
N'-butyl-N'-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 55218520) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N'-butyl-N'-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-butyl-N'-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 55218520 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N'-butyl-N'-[2-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | CCCCN(CCN)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-2-3-9-18(10-8-17)12-7-5-4-6-11(12)13(14,15)16/h4-7H,2-3,8-10,17H2,1H3 |
| InChIKey | RNKSYPHKHSSADN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |