About 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline
4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline (PubChem CID 107079764) has the molecular formula C16H23BrF3N
and a molecular weight of 366.27 g/mol. Its IUPAC name is 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline |
| PubChem CID | 107079764 |
| Molecular Formula | C16H23BrF3N |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline |
| SMILES | CCCCN(CCCC)c1ccc(CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C16H23BrF3N/c1-3-5-9-21(10-6-4-2)15-8-7-13(12-17)11-14(15)16(18,19)20/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | IDBAYWMMMZWNSA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline?
The IUPAC name of 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline (CID 107079764) is 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline.
What is the SMILES notation for 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline?
The canonical SMILES for 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline is CCCCN(CCCC)c1ccc(CBr)cc1C(F)(F)F.
What is the InChIKey of 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline?
The InChIKey is IDBAYWMMMZWNSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrF3N/c1-3-5-9-21(10-6-4-2)15-8-7-13(12-17)11-14(15)16(18,19)20/h7-8,11H,3-6,9-10,12H2,1-2H3.
What are the key properties of 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline?
4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline has a molecular weight of 366.27 g/mol, XLogP of 6.01, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline is sourced from PubChem (CID 107079764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).