C16H23BrF3N — CID 107079764
4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline (PubChem CID 107079764) has the molecular formula C16H23BrF3N and a molecular weight of 366.27 g/mol. Its IUPAC name is 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline.
| Compound Name | 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107079764 |
| Molecular Formula | C16H23BrF3N |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(bromomethyl)-N,N-dibutyl-2-(trifluoromethyl)aniline |
| SMILES | CCCCN(CCCC)c1ccc(CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C16H23BrF3N/c1-3-5-9-21(10-6-4-2)15-8-7-13(12-17)11-14(15)16(18,19)20/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | IDBAYWMMMZWNSA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|