C17H30N2 — CID 63786767
2-(2-aminopropyl)-N,N-dibutylaniline (PubChem CID 63786767) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-(2-aminopropyl)-N,N-dibutylaniline.
| Compound Name | 2-(2-aminopropyl)-N,N-dibutylaniline |
|---|---|
| PubChem CID | 63786767 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2-(2-aminopropyl)-N,N-dibutylaniline |
| SMILES | CCCCN(CCCC)c1ccccc1CC(C)N |
| InChI | InChI=1S/C17H30N2/c1-4-6-12-19(13-7-5-2)17-11-9-8-10-16(17)14-15(3)18/h8-11,15H,4-7,12-14,18H2,1-3H3 |
| InChIKey | RQYILFQUEOEKTL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |