C30H55NO — CID 141020309
2-(2-butoxy-5-tert-butyloctyl)-N,N-dibutylaniline (PubChem CID 141020309) has the molecular formula C30H55NO and a molecular weight of 445.78 g/mol. Its IUPAC name is 2-(2-butoxy-5-tert-butyloctyl)-N,N-dibutylaniline.
| Compound Name | 2-(2-butoxy-5-tert-butyloctyl)-N,N-dibutylaniline |
|---|---|
| PubChem CID | 141020309 |
| Molecular Formula | C30H55NO |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 445.43 |
| IUPAC Name | 2-(2-butoxy-5-tert-butyloctyl)-N,N-dibutylaniline |
| SMILES | CCCCOC(CCC(CCC)C(C)(C)C)Cc1ccccc1N(CCCC)CCCC |
| InChI | InChI=1S/C30H55NO/c1-8-12-22-31(23-13-9-2)29-19-16-15-18-26(29)25-28(32-24-14-10-3)21-20-27(17-11-4)30(5,6)7/h15-16,18-19,27-28H,8-14,17,20-25H2,1-7H3 |
| InChIKey | AOPYERYZRKMPCR-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|