C26H36Cl2O10 — CID 23425973
[(1R,2S,4R,6S,7S,10S,14R)-2,7-bis(chloromethyl)-11-(1,2-diacetyloxy-4-methylpent-3-enyl)-2,7-dihydroxy-5,13-dioxatricyclo[8.4.0.04,6]tetradec-11-en-14-yl] acetate (PubChem CID 23425973) has the molecular formula C26H36Cl2O10 and a molecular weight of 579.47 g/mol. Its IUPAC name is [(1R,2S,4R,6S,7S,10S,14R)-2,7-bis(chloromethyl)-11-(1,2-diacetyloxy-4-methylpent-3-enyl)-2,7-dihydroxy-5,13-dioxatricyclo[8.4.0.04,6]tetradec-11-en-14-yl] acetate.
| Compound Name | [(1R,2S,4R,6S,7S,10S,14R)-2,7-bis(chloromethyl)-11-(1,2-diacetyloxy-4-methylpent-3-enyl)-2,7-dihydroxy-5,13-dioxatricyclo[8.4.0.04,6]tetradec-11-en-14-yl] acetate |
|---|---|
| PubChem CID | 23425973 |
| Molecular Formula | C26H36Cl2O10 |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | [(1R,2S,4R,6S,7S,10S,14R)-2,7-bis(chloromethyl)-11-(1,2-diacetyloxy-4-methylpent-3-enyl)-2,7-dihydroxy-5,13-dioxatricyclo[8.4.0.04,6]tetradec-11-en-14-yl] acetate |
| SMILES | CC(=O)OC(C=C(C)C)C(OC(C)=O)C1=CO[C@H](OC(C)=O)[C@@H]2[C@@H]1CC[C@@](O)(CCl)[C@H]1O[C@@H]1C[C@@]2(O)CCl |
| InChI | InChI=1S/C26H36Cl2O10/c1-13(2)8-19(35-14(3)29)22(36-15(4)30)18-10-34-24(37-16(5)31)21-17(18)6-7-25(32,11-27)23-20(38-23)9-26(21,33)12-28/h8,10,17,19-24,32-33H,6-7,9,11-12H2,1-5H3/t17-,19?,20-,21+,22?,23+,24-,25-,26-/m1/s1 |
| InChIKey | NLALWPMOIJEHSQ-LMRQHGTLSA-N |
| XLogP | 2.74 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|