C20H30O2 — CID 23426995
(3aS,6S,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydrocyclopenta[11]annulene-2,4-dione (PubChem CID 23426995) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3aS,6S,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydrocyclopenta[11]annulene-2,4-dione.
| Compound Name | (3aS,6S,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydrocyclopenta[11]annulene-2,4-dione |
|---|---|
| PubChem CID | 23426995 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3aS,6S,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydrocyclopenta[11]annulene-2,4-dione |
| SMILES | CC(C)=C1C(=O)C[C@]2(C)C(=O)C[C@@H](C)CC/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C20H30O2/c1-13(2)19-16-10-9-14(3)7-6-8-15(4)11-18(22)20(16,5)12-17(19)21/h7,15-16H,6,8-12H2,1-5H3/b14-7+/t15-,16-,20-/m0/s1 |
| InChIKey | GRWHYYURDARQCI-NDOHKFJASA-N |
| XLogP | 5.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|