C20H32O2 — CID 23427248
(3aS,5S,6Z,9R,12aS)-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,5,8,9,11,12,12a-octahydro-2H-cyclopenta[11]annulene-5,9-diol (PubChem CID 23427248) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3aS,5S,6Z,9R,12aS)-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,5,8,9,11,12,12a-octahydro-2H-cyclopenta[11]annulene-5,9-diol.
| Compound Name | (3aS,5S,6Z,9R,12aS)-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,5,8,9,11,12,12a-octahydro-2H-cyclopenta[11]annulene-5,9-diol |
|---|---|
| PubChem CID | 23427248 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3aS,5S,6Z,9R,12aS)-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,5,8,9,11,12,12a-octahydro-2H-cyclopenta[11]annulene-5,9-diol |
| SMILES | C=C1CC[C@@H]2C(=C(C)C)CC[C@@]2(C)C[C@H](O)/C(C)=C\C[C@H]1O |
| InChI | InChI=1S/C20H32O2/c1-13(2)16-10-11-20(5)12-19(22)15(4)7-9-18(21)14(3)6-8-17(16)20/h7,17-19,21-22H,3,6,8-12H2,1-2,4-5H3/b15-7-/t17-,18-,19+,20+/m1/s1 |
| InChIKey | NIOCAVKAQAULTR-BBYQRLDHSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|