C21H25N5O4S2 — CID 23428749
3-[(5E)-5-[[5-cyano-2-(4-ethylpiperazin-1-yl)-1,4-dimethyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 23428749) has the molecular formula C21H25N5O4S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 3-[(5E)-5-[[5-cyano-2-(4-ethylpiperazin-1-yl)-1,4-dimethyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[5-cyano-2-(4-ethylpiperazin-1-yl)-1,4-dimethyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 23428749 |
| Molecular Formula | C21H25N5O4S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 3-[(5E)-5-[[5-cyano-2-(4-ethylpiperazin-1-yl)-1,4-dimethyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCN1CCN(c2c(/C=C3/SC(=S)N(CCC(=O)O)C3=O)c(C)c(C#N)c(=O)n2C)CC1 |
| InChI | InChI=1S/C21H25N5O4S2/c1-4-24-7-9-25(10-8-24)18-14(13(2)15(12-22)19(29)23(18)3)11-16-20(30)26(21(31)32-16)6-5-17(27)28/h11H,4-10H2,1-3H3,(H,27,28)/b16-11+ |
| InChIKey | BZFWNARNUPDLTA-LFIBNONCSA-N |
| XLogP | 1.38 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|