C28H31N5O4S2 — CID 6315500
6-[(5Z)-5-[[5-cyano-1,4-dimethyl-6-oxo-2-(4-phenylpiperazin-1-yl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 6315500) has the molecular formula C28H31N5O4S2 and a molecular weight of 565.72 g/mol. Its IUPAC name is 6-[(5Z)-5-[[5-cyano-1,4-dimethyl-6-oxo-2-(4-phenylpiperazin-1-yl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[5-cyano-1,4-dimethyl-6-oxo-2-(4-phenylpiperazin-1-yl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 6315500 |
| Molecular Formula | C28H31N5O4S2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 6-[(5Z)-5-[[5-cyano-1,4-dimethyl-6-oxo-2-(4-phenylpiperazin-1-yl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | Cc1c(/C=C2\SC(=S)N(CCCCCC(=O)O)C2=O)c(N2CCN(c3ccccc3)CC2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C28H31N5O4S2/c1-19-21(17-23-27(37)33(28(38)39-23)12-8-4-7-11-24(34)35)25(30(2)26(36)22(19)18-29)32-15-13-31(14-16-32)20-9-5-3-6-10-20/h3,5-6,9-10,17H,4,7-8,11-16H2,1-2H3,(H,34,35)/b23-17- |
| InChIKey | SRHNURKNBQDOIB-QJOMJCCJSA-N |
| XLogP | 3.74 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|