C26H29N5O3S2 — CID 23429373
1-ethyl-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile (PubChem CID 23429373) has the molecular formula C26H29N5O3S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 1-ethyl-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429373 |
| Molecular Formula | C26H29N5O3S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 1-ethyl-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
| SMILES | CCn1c(N2CCN(c3ccccc3)CC2)c(/C=C2/SC(=S)N(CCOC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H29N5O3S2/c1-4-30-23(29-12-10-28(11-13-29)19-8-6-5-7-9-19)20(18(2)21(17-27)24(30)32)16-22-25(33)31(14-15-34-3)26(35)36-22/h5-9,16H,4,10-15H2,1-3H3/b22-16+ |
| InChIKey | SPYSOZJIJVKDCD-CJLVFECKSA-N |
| XLogP | 3.22 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|