C20H24N4O2S2 — CID 23429476
6-(azepan-1-yl)-1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 23429476) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 6-(azepan-1-yl)-1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(azepan-1-yl)-1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429476 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6-(azepan-1-yl)-1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(N2CCCCCC2)c(/C=C2/SC(=S)N(C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C20H24N4O2S2/c1-4-24-17(23-9-7-5-6-8-10-23)14(13(2)15(12-21)18(24)25)11-16-19(26)22(3)20(27)28-16/h11H,4-10H2,1-3H3/b16-11+ |
| InChIKey | NMGISRUOSBWEHI-LFIBNONCSA-N |
| XLogP | 3.26 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|