C22H28N4O2S2 — CID 3356218
5-[(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-ethyl-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile (PubChem CID 3356218) has the molecular formula C22H28N4O2S2 and a molecular weight of 444.63 g/mol. Its IUPAC name is 5-[(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-ethyl-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 5-[(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-ethyl-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3356218 |
| Molecular Formula | C22H28N4O2S2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 5-[(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-ethyl-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
| SMILES | CCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CC)c2N2CCCCC2)SC1=S |
| InChI | InChI=1S/C22H28N4O2S2/c1-4-6-12-26-21(28)18(30-22(26)29)13-16-15(3)17(14-23)20(27)25(5-2)19(16)24-10-8-7-9-11-24/h13H,4-12H2,1-3H3 |
| InChIKey | HLNBANUMHBERHG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|