C24H32N4O2S2 — CID 23430214
1-butyl-5-[(E)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile (PubChem CID 23430214) has the molecular formula C24H32N4O2S2 and a molecular weight of 472.68 g/mol. Its IUPAC name is 1-butyl-5-[(E)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(E)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430214 |
| Molecular Formula | C24H32N4O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-butyl-5-[(E)-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-piperidin-1-ylpyridine-3-carbonitrile |
| SMILES | CCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCCC)c2N2CCCCC2)SC1=S |
| InChI | InChI=1S/C24H32N4O2S2/c1-4-6-13-27-21(26-11-9-8-10-12-26)18(17(3)19(16-25)22(27)29)15-20-23(30)28(14-7-5-2)24(31)32-20/h15H,4-14H2,1-3H3/b20-15+ |
| InChIKey | XZNZMJNLONJGRB-HMMYKYKNSA-N |
| XLogP | 4.82 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|