C22H28N4O3S2 — CID 23429576
5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-yl-1-propylpyridine-3-carbonitrile (PubChem CID 23429576) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-yl-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-yl-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429576 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-piperidin-1-yl-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(N2CCCCC2)c(/C=C2/SC(=S)N(CCOC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C22H28N4O3S2/c1-4-8-25-19(24-9-6-5-7-10-24)16(15(2)17(14-23)20(25)27)13-18-21(28)26(11-12-29-3)22(30)31-18/h13H,4-12H2,1-3H3/b18-13+ |
| InChIKey | UGQLYXARQFBYOB-QGOAFFKASA-N |
| XLogP | 3.28 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|