C10H14ClN3O — CID 23431722
(E)-3-(2,5-diaminophenyl)-N-methylprop-2-enamide;hydrochloride (PubChem CID 23431722) has the molecular formula C10H14ClN3O and a molecular weight of 227.70 g/mol. Its IUPAC name is (E)-3-(2,5-diaminophenyl)-N-methylprop-2-enamide;hydrochloride.
| Compound Name | (E)-3-(2,5-diaminophenyl)-N-methylprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 23431722 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (E)-3-(2,5-diaminophenyl)-N-methylprop-2-enamide;hydrochloride |
| SMILES | CNC(=O)/C=C/c1cc(N)ccc1N.Cl |
| InChI | InChI=1S/C10H13N3O.ClH/c1-13-10(14)5-2-7-6-8(11)3-4-9(7)12;/h2-6H,11-12H2,1H3,(H,13,14);1H/b5-2+; |
| InChIKey | ZZUHBCYSAUQHBV-DPZBITMOSA-N |
| XLogP | 1.03 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|