C24H27N3O4 — CID 23436203
2-[[4-(2-imidazol-1-ylethoxy)-2-phenylbenzoyl]amino]-4-methylpentanoic acid (PubChem CID 23436203) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[[4-(2-imidazol-1-ylethoxy)-2-phenylbenzoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-(2-imidazol-1-ylethoxy)-2-phenylbenzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23436203 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-[[4-(2-imidazol-1-ylethoxy)-2-phenylbenzoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1ccc(OCCn2ccnc2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H27N3O4/c1-17(2)14-22(24(29)30)26-23(28)20-9-8-19(31-13-12-27-11-10-25-16-27)15-21(20)18-6-4-3-5-7-18/h3-11,15-17,22H,12-14H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | CNHFDLPFXKHRKU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |