C15H19ClN2O3 — CID 23437239
2-[[4-amino-3-(2-hydroxyethyl)anilino]methyl]benzene-1,4-diol;hydrochloride (PubChem CID 23437239) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-[[4-amino-3-(2-hydroxyethyl)anilino]methyl]benzene-1,4-diol;hydrochloride.
| Compound Name | 2-[[4-amino-3-(2-hydroxyethyl)anilino]methyl]benzene-1,4-diol;hydrochloride |
|---|---|
| PubChem CID | 23437239 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[[4-amino-3-(2-hydroxyethyl)anilino]methyl]benzene-1,4-diol;hydrochloride |
| SMILES | Cl.Nc1ccc(NCc2cc(O)ccc2O)cc1CCO |
| InChI | InChI=1S/C15H18N2O3.ClH/c16-14-3-1-12(7-10(14)5-6-18)17-9-11-8-13(19)2-4-15(11)20;/h1-4,7-8,17-20H,5-6,9,16H2;1H |
| InChIKey | SGYWIVNEEWZYCM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|