C18H25NO5 — CID 2343743
[2-(cyclohexylamino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 2343743) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 2343743 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H25NO5/c1-22-15-9-8-13(10-16(15)23-2)11-18(21)24-12-17(20)19-14-6-4-3-5-7-14/h8-10,14H,3-7,11-12H2,1-2H3,(H,19,20) |
| InChIKey | HQEQGQZPMNMBTM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |