C28H26N6S — CID 23437874
4-(2,4-dimethylanilino)-7-[5-[[2-(1H-imidazol-5-yl)ethylamino]methyl]thiophen-3-yl]quinoline-3-carbonitrile (PubChem CID 23437874) has the molecular formula C28H26N6S and a molecular weight of 478.63 g/mol. Its IUPAC name is 4-(2,4-dimethylanilino)-7-[5-[[2-(1H-imidazol-5-yl)ethylamino]methyl]thiophen-3-yl]quinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dimethylanilino)-7-[5-[[2-(1H-imidazol-5-yl)ethylamino]methyl]thiophen-3-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23437874 |
| Molecular Formula | C28H26N6S |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-(2,4-dimethylanilino)-7-[5-[[2-(1H-imidazol-5-yl)ethylamino]methyl]thiophen-3-yl]quinoline-3-carbonitrile |
| SMILES | Cc1ccc(Nc2c(C#N)cnc3cc(-c4csc(CNCCc5cnc[nH]5)c4)ccc23)c(C)c1 |
| InChI | InChI=1S/C28H26N6S/c1-18-3-6-26(19(2)9-18)34-28-22(12-29)13-32-27-11-20(4-5-25(27)28)21-10-24(35-16-21)15-30-8-7-23-14-31-17-33-23/h3-6,9-11,13-14,16-17,30H,7-8,15H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | CDRJAWNOOOTCJY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|