C10H8Cl2F3NO2S — CID 23439412
N-(2,3-dichloro-4-sulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide (PubChem CID 23439412) has the molecular formula C10H8Cl2F3NO2S and a molecular weight of 334.15 g/mol. Its IUPAC name is N-(2,3-dichloro-4-sulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(2,3-dichloro-4-sulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 23439412 |
| Molecular Formula | C10H8Cl2F3NO2S |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | N-(2,3-dichloro-4-sulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide |
| SMILES | CC(O)(C(=O)Nc1ccc(S)c(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H8Cl2F3NO2S/c1-9(18,10(13,14)15)8(17)16-4-2-3-5(19)7(12)6(4)11/h2-3,18-19H,1H3,(H,16,17) |
| InChIKey | JMNBGKVIIYUIMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|