About (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate
(3-chloro-2-oxopropyl) 2-methylbenzenesulfonate (PubChem CID 23443884) has the molecular formula C10H11ClO4S
and a molecular weight of 262.71 g/mol. Its IUPAC name is (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate |
| PubChem CID | 23443884 |
| Molecular Formula | C10H11ClO4S |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCC(=O)CCl |
| InChI | InChI=1S/C10H11ClO4S/c1-8-4-2-3-5-10(8)16(13,14)15-7-9(12)6-11/h2-5H,6-7H2,1H3 |
| InChIKey | FPIRIBBEAJWISE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate?
The IUPAC name of (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate (CID 23443884) is (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate.
What is the SMILES notation for (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate?
The canonical SMILES for (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate is Cc1ccccc1S(=O)(=O)OCC(=O)CCl.
What is the InChIKey of (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate?
The InChIKey is FPIRIBBEAJWISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO4S/c1-8-4-2-3-5-10(8)16(13,14)15-7-9(12)6-11/h2-5H,6-7H2,1H3.
What are the key properties of (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate?
(3-chloro-2-oxopropyl) 2-methylbenzenesulfonate has a molecular weight of 262.71 g/mol, XLogP of 1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-oxopropyl) 2-methylbenzenesulfonate is sourced from PubChem (CID 23443884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).