About 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate
3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate (PubChem CID 174390135) has the molecular formula C17H21NO5S
and a molecular weight of 351.42 g/mol. Its IUPAC name is 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate |
| PubChem CID | 174390135 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCc1ccccc1.NCCC(=O)O |
| InChI | InChI=1S/C14H14O3S.C3H7NO2/c1-12-7-5-6-10-14(12)18(15,16)17-11-13-8-3-2-4-9-13;4-2-1-3(5)6/h2-10H,11H2,1H3;1-2,4H2,(H,5,6) |
| InChIKey | FSOMHTBOJQAZFO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate?
The IUPAC name of 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate (CID 174390135) is 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate.
What is the SMILES notation for 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate?
The canonical SMILES for 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate is Cc1ccccc1S(=O)(=O)OCc1ccccc1.NCCC(=O)O.
What is the InChIKey of 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate?
The InChIKey is FSOMHTBOJQAZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3S.C3H7NO2/c1-12-7-5-6-10-14(12)18(15,16)17-11-13-8-3-2-4-9-13;4-2-1-3(5)6/h2-10H,11H2,1H3;1-2,4H2,(H,5,6).
What are the key properties of 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate?
3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate has a molecular weight of 351.42 g/mol, XLogP of 2.32, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropanoic acid;benzyl 2-methylbenzenesulfonate is sourced from PubChem (CID 174390135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).