About benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene
benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene (PubChem CID 174490368) has the molecular formula C17H20BrNO4S
and a molecular weight of 414.32 g/mol. Its IUPAC name is benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene.
Molecular Properties
| Compound Name | benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene |
| PubChem CID | 174490368 |
| Molecular Formula | C17H20BrNO4S |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene |
| SMILES | Cc1ccccc1S(C)(=O)=O.O=C(CNBr)OCc1ccccc1 |
| InChI | InChI=1S/C9H10BrNO2.C8H10O2S/c10-11-6-9(12)13-7-8-4-2-1-3-5-8;1-7-5-3-4-6-8(7)11(2,9)10/h1-5,11H,6-7H2;3-6H,1-2H3 |
| InChIKey | MZGAJWURMOYNNS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene?
The IUPAC name of benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene (CID 174490368) is benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene.
What is the SMILES notation for benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene?
The canonical SMILES for benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene is Cc1ccccc1S(C)(=O)=O.O=C(CNBr)OCc1ccccc1.
What is the InChIKey of benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene?
The InChIKey is MZGAJWURMOYNNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2.C8H10O2S/c10-11-6-9(12)13-7-8-4-2-1-3-5-8;1-7-5-3-4-6-8(7)11(2,9)10/h1-5,11H,6-7H2;3-6H,1-2H3.
What are the key properties of benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene?
benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene has a molecular weight of 414.32 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(bromoamino)acetate;1-methyl-2-methylsulfonylbenzene is sourced from PubChem (CID 174490368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).