C18H22BrN5O2S — CID 23446215
S-[(3-methoxy-5,6-dimethylpyrazin-2-yl)amino] 4-(3-bromophenyl)piperazine-1-carbothioate (PubChem CID 23446215) has the molecular formula C18H22BrN5O2S and a molecular weight of 452.38 g/mol. Its IUPAC name is S-[(3-methoxy-5,6-dimethylpyrazin-2-yl)amino] 4-(3-bromophenyl)piperazine-1-carbothioate.
| Compound Name | S-[(3-methoxy-5,6-dimethylpyrazin-2-yl)amino] 4-(3-bromophenyl)piperazine-1-carbothioate |
|---|---|
| PubChem CID | 23446215 |
| Molecular Formula | C18H22BrN5O2S |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | S-[(3-methoxy-5,6-dimethylpyrazin-2-yl)amino] 4-(3-bromophenyl)piperazine-1-carbothioate |
| SMILES | COc1nc(C)c(C)nc1NSC(=O)N1CCN(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H22BrN5O2S/c1-12-13(2)21-17(26-3)16(20-12)22-27-18(25)24-9-7-23(8-10-24)15-6-4-5-14(19)11-15/h4-6,11H,7-10H2,1-3H3,(H,20,22) |
| InChIKey | WLQJRPNDQWEUND-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|