C20H26N4O2S — CID 22939045
S-[(2-methoxy-5,6-dimethyl-3-pyridinyl)amino] 4-(4-methylphenyl)piperazine-1-carbothioate (PubChem CID 22939045) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is S-[(2-methoxy-5,6-dimethyl-3-pyridinyl)amino] 4-(4-methylphenyl)piperazine-1-carbothioate.
| Compound Name | S-[(2-methoxy-5,6-dimethyl-3-pyridinyl)amino] 4-(4-methylphenyl)piperazine-1-carbothioate |
|---|---|
| PubChem CID | 22939045 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | S-[(2-methoxy-5,6-dimethyl-3-pyridinyl)amino] 4-(4-methylphenyl)piperazine-1-carbothioate |
| SMILES | COc1nc(C)c(C)cc1NSC(=O)N1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H26N4O2S/c1-14-5-7-17(8-6-14)23-9-11-24(12-10-23)20(25)27-22-18-13-15(2)16(3)21-19(18)26-4/h5-8,13,22H,9-12H2,1-4H3 |
| InChIKey | ZTULOQQDXUWOMG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|