C21H28N4O3 — CID 142628238
4-(3,5-dimethylphenyl)-N-(2-methoxy-5,6-dimethyl-3-pyridinyl)-1-oxidopiperazin-1-ium-1-carboxamide (PubChem CID 142628238) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-N-(2-methoxy-5,6-dimethyl-3-pyridinyl)-1-oxidopiperazin-1-ium-1-carboxamide.
| Compound Name | 4-(3,5-dimethylphenyl)-N-(2-methoxy-5,6-dimethyl-3-pyridinyl)-1-oxidopiperazin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 142628238 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-N-(2-methoxy-5,6-dimethyl-3-pyridinyl)-1-oxidopiperazin-1-ium-1-carboxamide |
| SMILES | COc1nc(C)c(C)cc1NC(=O)[N+]1([O-])CCN(c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-14-10-15(2)12-18(11-14)24-6-8-25(27,9-7-24)21(26)23-19-13-16(3)17(4)22-20(19)28-5/h10-13H,6-9H2,1-5H3,(H,23,26) |
| InChIKey | OLBNSNIQMBYCAG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|