C22H29N3O2S — CID 19357116
S-(2-methoxy-4,5-dimethylanilino) 4-(3,5-dimethylphenyl)piperazine-1-carbothioate (PubChem CID 19357116) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is S-(2-methoxy-4,5-dimethylanilino) 4-(3,5-dimethylphenyl)piperazine-1-carbothioate.
| Compound Name | S-(2-methoxy-4,5-dimethylanilino) 4-(3,5-dimethylphenyl)piperazine-1-carbothioate |
|---|---|
| PubChem CID | 19357116 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | S-(2-methoxy-4,5-dimethylanilino) 4-(3,5-dimethylphenyl)piperazine-1-carbothioate |
| SMILES | COc1cc(C)c(C)cc1NSC(=O)N1CCN(c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-15-10-16(2)12-19(11-15)24-6-8-25(9-7-24)22(26)28-23-20-13-17(3)18(4)14-21(20)27-5/h10-14,23H,6-9H2,1-5H3 |
| InChIKey | MBRQSZUQAHGIIS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|