C29H35N3O — CID 23447951
N,N-diethyl-4-[[1-(4-prop-2-enylpiperazin-1-yl)naphthalen-2-yl]methyl]benzamide (PubChem CID 23447951) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is N,N-diethyl-4-[[1-(4-prop-2-enylpiperazin-1-yl)naphthalen-2-yl]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[1-(4-prop-2-enylpiperazin-1-yl)naphthalen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 23447951 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | N,N-diethyl-4-[[1-(4-prop-2-enylpiperazin-1-yl)naphthalen-2-yl]methyl]benzamide |
| SMILES | C=CCN1CCN(c2c(Cc3ccc(C(=O)N(CC)CC)cc3)ccc3ccccc23)CC1 |
| InChI | InChI=1S/C29H35N3O/c1-4-17-30-18-20-32(21-19-30)28-26(16-15-24-9-7-8-10-27(24)28)22-23-11-13-25(14-12-23)29(33)31(5-2)6-3/h4,7-16H,1,5-6,17-22H2,2-3H3 |
| InChIKey | AHFWWCPOBDYAKS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|