C14H10Cl3F3N2O — CID 23452705
1-prop-2-ynyl-1-(2,3,3-trichloroprop-2-enyl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 23452705) has the molecular formula C14H10Cl3F3N2O and a molecular weight of 385.60 g/mol. Its IUPAC name is 1-prop-2-ynyl-1-(2,3,3-trichloroprop-2-enyl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-prop-2-ynyl-1-(2,3,3-trichloroprop-2-enyl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23452705 |
| Molecular Formula | C14H10Cl3F3N2O |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 1-prop-2-ynyl-1-(2,3,3-trichloroprop-2-enyl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | C#CCN(CC(Cl)=C(Cl)Cl)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H10Cl3F3N2O/c1-2-7-22(8-10(15)12(16)17)13(23)21-11-6-4-3-5-9(11)14(18,19)20/h1,3-6H,7-8H2,(H,21,23) |
| InChIKey | TUKDPWXXEZSOMT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|