C18H32N2 — CID 23455930
(5Z,9Z)-3,12-di(butan-2-yl)-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 23455930) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (5Z,9Z)-3,12-di(butan-2-yl)-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5Z,9Z)-3,12-di(butan-2-yl)-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 23455930 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (5Z,9Z)-3,12-di(butan-2-yl)-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCC(C)C1C/C=C\CC/C=C\CC(C(C)CC)/N=N/1 |
| InChI | InChI=1S/C18H32N2/c1-5-15(3)17-13-11-9-7-8-10-12-14-18(20-19-17)16(4)6-2/h9-12,15-18H,5-8,13-14H2,1-4H3/b11-9-,12-10-,20-19+ |
| InChIKey | XYJSWNYKPUXTQV-DGGNVIRQSA-N |
| XLogP | 5.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|