C16H18BrN3O2 — CID 23458535
3-bromo-2,2-dimethyl-N-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide (PubChem CID 23458535) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 3-bromo-2,2-dimethyl-N-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide.
| Compound Name | 3-bromo-2,2-dimethyl-N-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 23458535 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-bromo-2,2-dimethyl-N-[4-(5-oxo-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl)phenyl]propanamide |
| SMILES | CC(C)(CBr)C(=O)Nc1ccc(C2=NNC(=O)C3CC23)cc1 |
| InChI | InChI=1S/C16H18BrN3O2/c1-16(2,8-17)15(22)18-10-5-3-9(4-6-10)13-11-7-12(11)14(21)20-19-13/h3-6,11-12H,7-8H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | XEUOVVDKPHIBBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|