C28H40Cl2N2O3 — CID 23459050
1,2-bis(4-chlorophenyl)-2,2-bis[2-(diethylamino)propoxy]ethanone (PubChem CID 23459050) has the molecular formula C28H40Cl2N2O3 and a molecular weight of 523.55 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)-2,2-bis[2-(diethylamino)propoxy]ethanone.
| Compound Name | 1,2-bis(4-chlorophenyl)-2,2-bis[2-(diethylamino)propoxy]ethanone |
|---|---|
| PubChem CID | 23459050 |
| Molecular Formula | C28H40Cl2N2O3 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)-2,2-bis[2-(diethylamino)propoxy]ethanone |
| SMILES | CCN(CC)C(C)COC(OCC(C)N(CC)CC)(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H40Cl2N2O3/c1-7-31(8-2)21(5)19-34-28(24-13-17-26(30)18-14-24,35-20-22(6)32(9-3)10-4)27(33)23-11-15-25(29)16-12-23/h11-18,21-22H,7-10,19-20H2,1-6H3 |
| InChIKey | VJSKNURNKHURCR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|