C13H17ClO5 — CID 88505367
1-(4-chlorophenyl)-2-hydroperoxy-3-(2-hydroxypropoxy)-2-methylpropan-1-one (PubChem CID 88505367) has the molecular formula C13H17ClO5 and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-hydroperoxy-3-(2-hydroxypropoxy)-2-methylpropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-hydroperoxy-3-(2-hydroxypropoxy)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 88505367 |
| Molecular Formula | C13H17ClO5 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-(4-chlorophenyl)-2-hydroperoxy-3-(2-hydroxypropoxy)-2-methylpropan-1-one |
| SMILES | CC(O)COCC(C)(OO)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClO5/c1-9(15)7-18-8-13(2,19-17)12(16)10-3-5-11(14)6-4-10/h3-6,9,15,17H,7-8H2,1-2H3 |
| InChIKey | YLYBZCZYESHVGD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|