C10H9N3O2S — CID 23461482
N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 23461482) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23461482 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | N#CC1CN1C(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C10H9N3O2S/c11-4-7-6-13(7)9(14)5-12-10(15)8-2-1-3-16-8/h1-3,7H,5-6H2,(H,12,15) |
| InChIKey | IJTPKBGPDFJXAU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|